Bộ 30 đề thi vào 10 Chuyên Hóa năm 2022-2023 có lời giải chi tiết ( Đề 17)

  • 15631 lượt thi

  • 17 câu hỏi

  • 45 phút

Câu 1:

Xác định các chất X1, X2, X3, X4 và viết các phương trình hóa học (ghi rõ điều kiện xảy ra, nếu có) của các phản ứng theo sơ đồ sau:

C4H10(1)X1(2)CH3COOC2H5(3)CO2(4)X2 (5) Cu (6)X3 (7)FeSO4 (8)FeCl3 (9)X4 (10)Fe2O3

Xem đáp án

Ta có: X1: CH3COOH; X2: CO; X3: CuSO4; X4: Fe(OH)3.

Phương trình hóa học:

C4H10 + O2 to, xt  2CH3COOH + H2O

CH3COOH + C2H5OH H2SO4,t°  CH3COOC2H5 + H2O

CH3COOC2H5 + 5O2  to4CO2 + 4H2O

CO2 + C to 2CO

CO + CuO to  Cu + CO2

Cu + 2H2SO4 đặc  toCuSO4 + SO2 + 2H2O

CuSO4 + Fe → FeSO4 + Cu

6FeSO4 + 3Cl2 → 2FeCl3 + 2Fe2(SO4)3

Fe2(SO4)3 + 6NaOH → 2Fe(OH)3↓ + 3Na2SO4

2Fe(OH)3 to  Fe2O3 + 3H2O


Câu 3:

b. Cho từ từ đến dư dung dịch Ba(OH)2 vào dung dịch Al2(SO4)3.

Xem đáp án

b. Hiện tượng: Xuất hiện kết tủa trắng sau đó kết tủa tan dần một phần.

Phương trình hóa học:

3Ba(OH)2 + Al2(SO4)3 → 3BaSO4↓ + 2Al(OH)3

Ba(OH)2 + 2Al(OH)3 → Ba(AlO2)2 + 4H2O


Câu 4:

c. Đun nóng ống nghiệm chứa nước ép quả nho chín và dung dịch bạc nitrat trong amoniac.

Xem đáp án

c. Hiện tượng: Xuất hiện kết tủa trắng bạc trên thành ống nghiệm.

Phương trình hóa học:

C6H12O6 + 2AgNO3 + 3NH3 + H2O C5H11O5-COONH4 + 2Ag↓ + 2NH4NO3

(Hoặc: C6H12O6 + Ag2O C6H12O7 + 2Ag).


Câu 5:

d. Đốt cháy rượu etylic, dùng ống nghiệm úp phía trên ngọn lửa. Sau đó, rót nước vôi trong vào ống nghiệm, lắc nhẹ.

Xem đáp án

d. Hiện tượng: Xuất hiện kết tủa trắng.

Phương trình hóa học:

C2H5OH + 3O2 to  2CO2 + 3H2O

CO2 + Ca(OH)2 → CaCO3↓ + H2O


Bài thi liên quan:

Các bài thi hot trong chương:

5

Đánh giá trung bình

100%

0%

0%

0%

0%

Nhận xét

H

1 năm trước

Hân Nguyễn

T

9 tháng trước

TÂY TÂY

Bình luận


Bình luận