Bộ 30 đề thi vào 10 Chuyên Hóa năm 2022-2023 có lời giải chi tiết ( Đề 21)

  • 15656 lượt thi

  • 11 câu hỏi

  • 45 phút

Câu 1:

Cho chuỗi phản ứng sau (mỗi mũi tên ứng với một phương trình hóa học):

C2H4(1)C2H5OH(2)CH3COOH(3)CH3COOC2H5 (4)CH3COONa(5)CH4

Viết phương trình hóa học thực hiện chuỗi phản ứng trên (ghi rõ điều kiện nếu có).

Xem đáp án

Phương trình hóa học minh họa chuỗi phản ứng:

(1) CH2 = CH2 + H2O to, axit CH3CH2OH

(2) CH3CH2OH + O2 men  giamCH3COOH + H2O

(3) CH3COOH + CH3CH2OH toH2SO4CH3COOCH2CH3 + H2O

(4) CH3COOCH2CH3 + NaOH to CH3COONa + H2O

(5) CH3COONa + NaOH to,CaO CH4↑ + Na2CO3


Câu 2:

Viết công thức phân tử của các chất ứng với các kí hiệu X1, X2, X3, X4, X5 và hoàn thành phương trình hoá học của các sơ đồ phản ứng sau:

X1 + H2O dienphandungdichcomangngan X2 + X3↑ + H2

X2 + X4  BaCO3↓+ Na2CO3 + H2O

X2 + X3  X1 + NaClO + H2O

X4 + X5 BaSO4↓ + CO2↓ + H2O

Xem đáp án

Các chất X1: NaCl; X2: NaOH; X3: Cl2; X4: Ba(HCO3)2; X5: H2SO4.

(1) 2NaCl (X1) + 2H2O dpddcmn 2NaOH (X2) + Cl2↑ (X3)  + H2

(2) 2NaOH + Ba(HCO3)2 (X4) → BaCO3↓ + Na2CO3 + 2H2O

(3) 2NaOH + Cl2 → NaCl + NaClO + H2O

(4) Ba(HCO3)2 + H2SO4 (X5) → BaSO4↓ + 2CO2↓ + 2H2O


Câu 3:

Hỗn hợp X gồm MgO, Al2O3, Fe3O4, CuO. Cho khí CO dư qua X nung nóng được chất rắn Y. Hòa tan Y vào dung dịch KOH dư được dung dịch Z và chất rắn T. Hoà tan chất rắn T vào dung dịch H2SO4 loãng dư. Cho dung dịch HCl đến dư vào dung dịch Z thấy xuất hiện kết tủa, sau đó kết tủa tan dần đến hết. Viết phương trình hóa học của các phản ứng xảy ra (ghi rõ điều kiện phản ứng nếu có), biết các phản ứng xảy ra hoàn toàn.

Xem đáp án

Các phương trình hóa học của phản ứng xảy ra:

- Cho khí CO dư qua X gồm MgO, Al2O3, Fe3O4, CuO.

(1) Fe3O4 + 4CO t0 3Fe + 4CO2

(2) CuO + CO t0Cu + CO2

- Chất rắn Y gồm gồm MgO, Al2O3, Fe, Cu tác dụng KOH dư được dung dịch Z và chất rắn T

(3) Al2O3 + 2KOH → 2KAlO2 + H2O

- Hòa tan T gồm MgO, Fe, Cu bằng dung dịch SO4 loãng, dư

(4) MgO + H2SO4 MgSO4 + H2O

(5) Fe + H2SO4 FeSO4 + H2

- Cho HCl đến dư vào dung dịch X gồm KAlO2, KOH dư

(6) KOH + HCl KCl+ H2O

(7) KAlO2 + HCl KCl + Al(OH)3↓ + H2O

(8) Al(OH)3  + 3HCl AlCl3 + 3H2O


Câu 4:

Hình vẽ bên là thiết bị điều chế khí Y trong phòng thí nghiệm.

Hình vẽ bên là thiết bị điều chế khí Y trong phòng thí nghiệm. (ảnh 1)

Khí Y có thể là khi nào trong 2 khí sau: metan, axetilen. Biết khí Y làm mất màu dung dịch brom.

- Xác định công thức cấu tạo của Y.

- Viết phương trình điều chế Y, phản ứng hóa học Y tác dụng với dung dịch brom dư.

Xem đáp án

- Vì Y làm mất màu dung dịch brom, tạo ra từ chất rắn X tác dụng với H2O, không tan trong nước (thu bằng phương pháp dời nước) nên Y là axetilen.

Công thức cấu tạo của Y: CH ≡ CH.

- Phương trình hóa học:

+ Phương trình hóa học điều chế Y:

CaC2 + 2H2O → CH ≡ CH↑ + Ca(OH)2

+ Cho Y tác dụng với Br2 dư:

CH ≡ CH + 2Br2 → CHBr2 – CHBr2


Câu 5:

Hòa tan hoàn toàn 28,4 gam hỗn hợp X gồm MgCO3 và muối cacbonat của kim loại M bằng lượng vừa đủ dung dịch HCl 7,3% thu được dung dịch Y và 6,72 lít khí CO2 (ở điều kiện tiêu chuẩn). Thêm 64,8 gam nước vào dung dịch Y được dung dịch Z. Nồng độ của MgCl2 trong dung dịch Z là 5%. Xác định công thức muối cacbonat và tính thành phần phần trăm theo khối lượng của mỗi chất trong hỗn hợp X.

Xem đáp án

Hỗn hợp X gồm MgCO3 và muối cacbonat của kim loại M:

Đặt công thức của muối là M2(CO3)a; số mol MgCO3 là x (mol); M2(CO3)a là y (mol).

m = 84x + (2M + 60a)y = 28,4                 (*)

Khi X tác dụng HCl

MgCO3 + 2HCl → MgCl2 + H2O + CO2                  (1)

x………… 2x…….. x …………… x                     (mol)

M2(CO3)a + 2aHCl → 2MCla + aH2O + aCO2          (2)

y ………..   2ay …… 2y …………….. ay              (mol)

Theo phương trình hóa học (1), (2) số mol CO2 = x + ay = 0,3    (**)

Theo PTHH (1), (2) số mol HCl = 2x + 2ay = 0,6

mdd HCl=0,6×36,57,3×100=300 (gam)

Bảo toàn khối lượng:

28,4 + 300 = mdd Y + 0,3.44  mdd Y = 315,2 (gam)

Khi thêm H2O vào Y: mdd Z = 315,2 + 64,8 = 380 gam

Nồng độ của MgCl2: C%=95x380×100=5                (***)

Từ (*), (**), (***) ta có: x = 0,2; ay = 0,1; M = 28a

 a = 2; M = 56 (Fe); x = 0,2; y = 0,05.

Vậy công thức muối: FeCO3

Thành phần % khối lượng mỗi chất trong X:

%mMgCO3=0,2×8428,4×100%=59,15%

+ %mFeCO3=100%59,15%=40,85%.


Bài thi liên quan:

Các bài thi hot trong chương:

5

Đánh giá trung bình

100%

0%

0%

0%

0%

Nhận xét

H

1 năm trước

Hân Nguyễn

T

9 tháng trước

TÂY TÂY

Bình luận


Bình luận